C30H41N9O2 — CID 123701422
4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(2-methylindazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide (PubChem CID 123701422) has the molecular formula C30H41N9O2 and a molecular weight of 559.72 g/mol. Its IUPAC name is 4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(2-methylindazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide.
| Compound Name | 4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(2-methylindazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 123701422 |
| Molecular Formula | C30H41N9O2 |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | 4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(2-methylindazol-5-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide |
| SMILES | CCCNc1nc(Nc2ccc3nn(C)cc3c2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)C=CCN(C)C |
| InChI | InChI=1S/C30H41N9O2/c1-7-16-31-28-23(20-33-30(35-28)34-25-14-15-26-24(19-25)21-38(5)36-26)12-9-8-10-17-32-29(41)22(2)39(6)27(40)13-11-18-37(3)4/h11,13-15,19-22H,7-8,10,16-18H2,1-6H3,(H,32,41)(H2,31,33,34,35)/t22-/m0/s1 |
| InChIKey | ANSTZMMSYWUXQN-QFIPXVFZSA-N |
| XLogP | 3.14 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|