C29H36N8O2 — CID 123660643
N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(cyclopropylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide (PubChem CID 123660643) has the molecular formula C29H36N8O2 and a molecular weight of 528.66 g/mol. Its IUPAC name is N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(cyclopropylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide.
| Compound Name | N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(cyclopropylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 123660643 |
| Molecular Formula | C29H36N8O2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(cyclopropylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
| SMILES | C[C@@H](C(=O)NCCCC#Cc1cnc(Nc2ccc(C#N)cc2)nc1NC1CC1)N(C)C(=O)C=CCN(C)C |
| InChI | InChI=1S/C29H36N8O2/c1-21(37(4)26(38)10-8-18-36(2)3)28(39)31-17-7-5-6-9-23-20-32-29(35-27(23)33-24-15-16-24)34-25-13-11-22(19-30)12-14-25/h8,10-14,20-21,24H,5,7,15-18H2,1-4H3,(H,31,39)(H2,32,33,34,35)/t21-/m0/s1 |
| InChIKey | NHEOYXUQPNRWTP-NRFANRHFSA-N |
| XLogP | 2.88 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|