C31H39FN8O2 — CID 90051953
(E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(4-fluoropiperidin-1-yl)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide (PubChem CID 90051953) has the molecular formula C31H39FN8O2 and a molecular weight of 574.71 g/mol. Its IUPAC name is (E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(4-fluoropiperidin-1-yl)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide.
| Compound Name | (E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(4-fluoropiperidin-1-yl)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 90051953 |
| Molecular Formula | C31H39FN8O2 |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | (E)-N-[(2S)-1-[5-[2-(4-cyanoanilino)-4-(4-fluoropiperidin-1-yl)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]-4-(dimethylamino)-N-methylbut-2-enamide |
| SMILES | C[C@@H](C(=O)NCCCC#Cc1cnc(Nc2ccc(C#N)cc2)nc1N1CCC(F)CC1)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C31H39FN8O2/c1-23(39(4)28(41)10-8-18-38(2)3)30(42)34-17-7-5-6-9-25-22-35-31(36-27-13-11-24(21-33)12-14-27)37-29(25)40-19-15-26(32)16-20-40/h8,10-14,22-23,26H,5,7,15-20H2,1-4H3,(H,34,42)(H,35,36,37)/b10-8+/t23-/m0/s1 |
| InChIKey | JORCKXJJXMWRBQ-LBQODKDLSA-N |
| XLogP | 3.24 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|