C28H36FN7O2 — CID 90053405
(2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]azetidine-2-carboxamide (PubChem CID 90053405) has the molecular formula C28H36FN7O2 and a molecular weight of 521.64 g/mol. Its IUPAC name is (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]azetidine-2-carboxamide.
| Compound Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]azetidine-2-carboxamide |
|---|---|
| PubChem CID | 90053405 |
| Molecular Formula | C28H36FN7O2 |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | (2S)-1-[(E)-4-(dimethylamino)but-2-enoyl]-N-[5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]azetidine-2-carboxamide |
| SMILES | CCCNc1nc(Nc2cccc(F)c2)ncc1C#CCCCNC(=O)[C@@H]1CCN1C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C28H36FN7O2/c1-4-15-30-26-21(20-32-28(34-26)33-23-12-8-11-22(29)19-23)10-6-5-7-16-31-27(38)24-14-18-36(24)25(37)13-9-17-35(2)3/h8-9,11-13,19-20,24H,4-5,7,14-18H2,1-3H3,(H,31,38)(H2,30,32,33,34)/b13-9+/t24-/m0/s1 |
| InChIKey | ZLRVIRJRTFHXIO-JEAXJQIYSA-N |
| XLogP | 3.15 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|