C27H36FN7O2 — CID 90053447
N-[2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]ethyl]-5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynamide (PubChem CID 90053447) has the molecular formula C27H36FN7O2 and a molecular weight of 509.63 g/mol. Its IUPAC name is N-[2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]ethyl]-5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynamide.
| Compound Name | N-[2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]ethyl]-5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynamide |
|---|---|
| PubChem CID | 90053447 |
| Molecular Formula | C27H36FN7O2 |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | N-[2-[[(E)-4-(dimethylamino)but-2-enoyl]-methylamino]ethyl]-5-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynamide |
| SMILES | CCCNc1nc(Nc2cccc(F)c2)ncc1C#CCCC(=O)NCCN(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C27H36FN7O2/c1-5-15-30-26-21(20-31-27(33-26)32-23-12-8-11-22(28)19-23)10-6-7-13-24(36)29-16-18-35(4)25(37)14-9-17-34(2)3/h8-9,11-12,14,19-20H,5,7,13,15-18H2,1-4H3,(H,29,36)(H2,30,31,32,33)/b14-9+ |
| InChIKey | NBZKNLOCXPKARE-NTEUORMPSA-N |
| XLogP | 3.01 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|