C27H35FN6O4 — CID 90051899
tert-butyl (2S,4S)-2-[5-[2-(4-fluoroanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]-4-hydroxy-2-methylpyrrolidine-1-carboxylate (PubChem CID 90051899) has the molecular formula C27H35FN6O4 and a molecular weight of 526.61 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[5-[2-(4-fluoroanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]-4-hydroxy-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-[5-[2-(4-fluoroanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]-4-hydroxy-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90051899 |
| Molecular Formula | C27H35FN6O4 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | tert-butyl (2S,4S)-2-[5-[2-(4-fluoroanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]-4-hydroxy-2-methylpyrrolidine-1-carboxylate |
| SMILES | CNc1nc(Nc2ccc(F)cc2)ncc1C#CCCCNC(=O)[C@]1(C)C[C@H](O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H35FN6O4/c1-26(2,3)38-25(37)34-17-21(35)15-27(34,4)23(36)30-14-8-6-7-9-18-16-31-24(33-22(18)29-5)32-20-12-10-19(28)11-13-20/h10-13,16,21,35H,6,8,14-15,17H2,1-5H3,(H,30,36)(H2,29,31,32,33)/t21-,27-/m0/s1 |
| InChIKey | IBDYYBNNULHTHJ-IDISGSTGSA-N |
| XLogP | 3.41 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|