C30H39FN8O3 — CID 90052976
tert-butyl (2S)-2-[5-[2-[(3-fluoro-1-methylindazol-6-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 90052976) has the molecular formula C30H39FN8O3 and a molecular weight of 578.69 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[2-[(3-fluoro-1-methylindazol-6-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[2-[(3-fluoro-1-methylindazol-6-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90052976 |
| Molecular Formula | C30H39FN8O3 |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | tert-butyl (2S)-2-[5-[2-[(3-fluoro-1-methylindazol-6-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CCCNc1nc(Nc2ccc3c(F)nn(C)c3c2)ncc1C#CCCCNC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H39FN8O3/c1-6-15-32-26-20(19-34-28(36-26)35-21-13-14-22-24(18-21)38(5)37-25(22)31)11-8-7-9-16-33-27(40)23-12-10-17-39(23)29(41)42-30(2,3)4/h13-14,18-19,23H,6-7,9-10,12,15-17H2,1-5H3,(H,33,40)(H2,32,34,35,36)/t23-/m0/s1 |
| InChIKey | JYRFTZOWMROLIP-QHCPKHFHSA-N |
| XLogP | 4.72 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|