C27H33N7O3 — CID 90052858
tert-butyl (2S)-2-[5-[2-(4-cyanoanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate (PubChem CID 90052858) has the molecular formula C27H33N7O3 and a molecular weight of 503.61 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[2-(4-cyanoanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[2-(4-cyanoanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90052858 |
| Molecular Formula | C27H33N7O3 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | tert-butyl (2S)-2-[5-[2-(4-cyanoanilino)-4-(methylamino)pyrimidin-5-yl]pent-4-ynylcarbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CNc1nc(Nc2ccc(C#N)cc2)ncc1C#CCCCNC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H33N7O3/c1-27(2,3)37-26(36)34-16-8-10-22(34)24(35)30-15-7-5-6-9-20-18-31-25(33-23(20)29-4)32-21-13-11-19(17-28)12-14-21/h11-14,18,22H,5,7-8,10,15-16H2,1-4H3,(H,30,35)(H2,29,31,32,33)/t22-/m0/s1 |
| InChIKey | BIPVWBCPGYFXKY-QFIPXVFZSA-N |
| XLogP | 3.78 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|