C27H34N6O3 — CID 153188837
tert-butyl 6-[3-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]prop-2-ynylamino]-6-oxohexanoate (PubChem CID 153188837) has the molecular formula C27H34N6O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is tert-butyl 6-[3-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]prop-2-ynylamino]-6-oxohexanoate.
| Compound Name | tert-butyl 6-[3-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]prop-2-ynylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 153188837 |
| Molecular Formula | C27H34N6O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | tert-butyl 6-[3-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]prop-2-ynylamino]-6-oxohexanoate |
| SMILES | CCCNc1nc(Nc2ccc(C#N)cc2)ncc1C#CCNC(=O)CCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H34N6O3/c1-5-16-30-25-21(19-31-26(33-25)32-22-14-12-20(18-28)13-15-22)9-8-17-29-23(34)10-6-7-11-24(35)36-27(2,3)4/h12-15,19H,5-7,10-11,16-17H2,1-4H3,(H,29,34)(H2,30,31,32,33) |
| InChIKey | WHPRRJWVICRFGK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|