C20H29N3O3 — CID 10760938
tert-butyl 7-[[2-(4-cyanoanilino)acetyl]amino]heptanoate (PubChem CID 10760938) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl 7-[[2-(4-cyanoanilino)acetyl]amino]heptanoate.
| Compound Name | tert-butyl 7-[[2-(4-cyanoanilino)acetyl]amino]heptanoate |
|---|---|
| PubChem CID | 10760938 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | tert-butyl 7-[[2-(4-cyanoanilino)acetyl]amino]heptanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCNC(=O)CNc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H29N3O3/c1-20(2,3)26-19(25)8-6-4-5-7-13-22-18(24)15-23-17-11-9-16(14-21)10-12-17/h9-12,23H,4-8,13,15H2,1-3H3,(H,22,24) |
| InChIKey | SAORGGWDVMKBNA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|