C15H21N3O3 — CID 67540537
tert-butyl N-[3-(4-cyanoanilino)-2-hydroxypropyl]carbamate (PubChem CID 67540537) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl N-[3-(4-cyanoanilino)-2-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-cyanoanilino)-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 67540537 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tert-butyl N-[3-(4-cyanoanilino)-2-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)CNc1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H21N3O3/c1-15(2,3)21-14(20)18-10-13(19)9-17-12-6-4-11(8-16)5-7-12/h4-7,13,17,19H,9-10H2,1-3H3,(H,18,20) |
| InChIKey | MMRACXGTFKTLBU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |