C16H22N2O6S — CID 87919430
[(2R)-1-(4-cyanophenoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] methanesulfonate (PubChem CID 87919430) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is [(2R)-1-(4-cyanophenoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] methanesulfonate.
| Compound Name | [(2R)-1-(4-cyanophenoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 87919430 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [(2R)-1-(4-cyanophenoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](COc1ccc(C#N)cc1)OS(C)(=O)=O |
| InChI | InChI=1S/C16H22N2O6S/c1-16(2,3)23-15(19)18-10-14(24-25(4,20)21)11-22-13-7-5-12(9-17)6-8-13/h5-8,14H,10-11H2,1-4H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | GNCZCKKIFRXCEB-CQSZACIVSA-N |
| XLogP | 1.81 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|