C16H23N3O4S — CID 129410336
tert-butyl N-[(2S)-3-[(4-cyanophenyl)sulfonylamino]-2-methylpropyl]carbamate (PubChem CID 129410336) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-[(4-cyanophenyl)sulfonylamino]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-[(4-cyanophenyl)sulfonylamino]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 129410336 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | tert-butyl N-[(2S)-3-[(4-cyanophenyl)sulfonylamino]-2-methylpropyl]carbamate |
| SMILES | C[C@@H](CNC(=O)OC(C)(C)C)CNS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H23N3O4S/c1-12(10-18-15(20)23-16(2,3)4)11-19-24(21,22)14-7-5-13(9-17)6-8-14/h5-8,12,19H,10-11H2,1-4H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | VPGYRWZDAJUZKF-LBPRGKRZSA-N |
| XLogP | 2.00 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |