C18H28N2O5S — CID 134971085
tert-butyl N-[(Z,2R,5R)-5-hydroxy-1-[(4-methylphenyl)sulfonylamino]hex-3-en-2-yl]carbamate (PubChem CID 134971085) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is tert-butyl N-[(Z,2R,5R)-5-hydroxy-1-[(4-methylphenyl)sulfonylamino]hex-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z,2R,5R)-5-hydroxy-1-[(4-methylphenyl)sulfonylamino]hex-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134971085 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | tert-butyl N-[(Z,2R,5R)-5-hydroxy-1-[(4-methylphenyl)sulfonylamino]hex-3-en-2-yl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@@H](/C=C\[C@@H](C)O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O5S/c1-13-6-10-16(11-7-13)26(23,24)19-12-15(9-8-14(2)21)20-17(22)25-18(3,4)5/h6-11,14-15,19,21H,12H2,1-5H3,(H,20,22)/b9-8-/t14-,15-/m1/s1 |
| InChIKey | OGXJUXDDCLHVOL-SFRZCGLPSA-N |
| XLogP | 2.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|