C16H23NO4S — CID 10404064
methyl (Z,4R)-5-methyl-4-[[(4-methylphenyl)sulfonylamino]methyl]hex-2-enoate (PubChem CID 10404064) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is methyl (Z,4R)-5-methyl-4-[[(4-methylphenyl)sulfonylamino]methyl]hex-2-enoate.
| Compound Name | methyl (Z,4R)-5-methyl-4-[[(4-methylphenyl)sulfonylamino]methyl]hex-2-enoate |
|---|---|
| PubChem CID | 10404064 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | methyl (Z,4R)-5-methyl-4-[[(4-methylphenyl)sulfonylamino]methyl]hex-2-enoate |
| SMILES | COC(=O)/C=C\[C@H](CNS(=O)(=O)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C16H23NO4S/c1-12(2)14(7-10-16(18)21-4)11-17-22(19,20)15-8-5-13(3)6-9-15/h5-10,12,14,17H,11H2,1-4H3/b10-7-/t14-/m1/s1 |
| InChIKey | MKTUHCALKZKTBP-JKEYDSJLSA-N |
| XLogP | 2.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|