C16H23NO5S — CID 24764386
methyl (E,4S,5S)-4-ethoxy-5-[(4-methylphenyl)sulfonylamino]hex-2-enoate (PubChem CID 24764386) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is methyl (E,4S,5S)-4-ethoxy-5-[(4-methylphenyl)sulfonylamino]hex-2-enoate.
| Compound Name | methyl (E,4S,5S)-4-ethoxy-5-[(4-methylphenyl)sulfonylamino]hex-2-enoate |
|---|---|
| PubChem CID | 24764386 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl (E,4S,5S)-4-ethoxy-5-[(4-methylphenyl)sulfonylamino]hex-2-enoate |
| SMILES | CCO[C@@H](/C=C/C(=O)OC)[C@H](C)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H23NO5S/c1-5-22-15(10-11-16(18)21-4)13(3)17-23(19,20)14-8-6-12(2)7-9-14/h6-11,13,15,17H,5H2,1-4H3/b11-10+/t13-,15-/m0/s1 |
| InChIKey | YRBKMZVQGAWDBP-GGBPEREOSA-N |
| XLogP | 1.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|