C23H27N3O6S3 — CID 175193129
N-[2,2-bis[(4-methylphenyl)sulfonylamino]ethyl]-4-methylbenzenesulfonamide (PubChem CID 175193129) has the molecular formula C23H27N3O6S3 and a molecular weight of 537.69 g/mol. Its IUPAC name is N-[2,2-bis[(4-methylphenyl)sulfonylamino]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2,2-bis[(4-methylphenyl)sulfonylamino]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 175193129 |
| Molecular Formula | C23H27N3O6S3 |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | N-[2,2-bis[(4-methylphenyl)sulfonylamino]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(NS(=O)(=O)c2ccc(C)cc2)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H27N3O6S3/c1-17-4-10-20(11-5-17)33(27,28)24-16-23(25-34(29,30)21-12-6-18(2)7-13-21)26-35(31,32)22-14-8-19(3)9-15-22/h4-15,23-26H,16H2,1-3H3 |
| InChIKey | LJMYTOQDFKBWGA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|