C16H18ClN3O6S2 — CID 22004248
3-[(4-chlorophenyl)sulfonylamino]-N-hydroxy-2-[(4-methylphenyl)sulfonylamino]propanamide (PubChem CID 22004248) has the molecular formula C16H18ClN3O6S2 and a molecular weight of 447.92 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-N-hydroxy-2-[(4-methylphenyl)sulfonylamino]propanamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-N-hydroxy-2-[(4-methylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 22004248 |
| Molecular Formula | C16H18ClN3O6S2 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-N-hydroxy-2-[(4-methylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CNS(=O)(=O)c2ccc(Cl)cc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C16H18ClN3O6S2/c1-11-2-6-14(7-3-11)28(25,26)20-15(16(21)19-22)10-18-27(23,24)13-8-4-12(17)5-9-13/h2-9,15,18,20,22H,10H2,1H3,(H,19,21) |
| InChIKey | WETUKEWLJXBQML-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|