C19H26ClN3O7S2 — CID 54394714
3-[(4-chlorophenyl)sulfonylamino]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-N-hydroxypropanamide (PubChem CID 54394714) has the molecular formula C19H26ClN3O7S2 and a molecular weight of 508.02 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-N-hydroxypropanamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 54394714 |
| Molecular Formula | C19H26ClN3O7S2 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-N-hydroxypropanamide |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)NC(CNS(=O)(=O)c1ccc(Cl)cc1)C(=O)NO)C(=O)C2 |
| InChI | InChI=1S/C19H26ClN3O7S2/c1-18(2)12-7-8-19(18,16(24)9-12)11-31(27,28)23-15(17(25)22-26)10-21-32(29,30)14-5-3-13(20)4-6-14/h3-6,12,15,21,23,26H,7-11H2,1-2H3,(H,22,25) |
| InChIKey | VJCVKERUMZPLCK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|