C23H29N3O7S2 — CID 54283206
3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-N-hydroxy-2-(naphthalen-1-ylsulfonylamino)propanamide (PubChem CID 54283206) has the molecular formula C23H29N3O7S2 and a molecular weight of 523.63 g/mol. Its IUPAC name is 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-N-hydroxy-2-(naphthalen-1-ylsulfonylamino)propanamide.
| Compound Name | 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-N-hydroxy-2-(naphthalen-1-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 54283206 |
| Molecular Formula | C23H29N3O7S2 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]-N-hydroxy-2-(naphthalen-1-ylsulfonylamino)propanamide |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)NCC(NS(=O)(=O)c1cccc3ccccc13)C(=O)NO)C(=O)C2 |
| InChI | InChI=1S/C23H29N3O7S2/c1-22(2)16-10-11-23(22,20(27)12-16)14-34(30,31)24-13-18(21(28)25-29)26-35(32,33)19-9-5-7-15-6-3-4-8-17(15)19/h3-9,16,18,24,26,29H,10-14H2,1-2H3,(H,25,28) |
| InChIKey | RSGFGRWJKOZUME-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|