C21H20Cl2N2O2S — CID 51356051
N-[2-(4-chloroanilino)-2-(4-chlorophenyl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 51356051) has the molecular formula C21H20Cl2N2O2S and a molecular weight of 435.38 g/mol. Its IUPAC name is N-[2-(4-chloroanilino)-2-(4-chlorophenyl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-chloroanilino)-2-(4-chlorophenyl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 51356051 |
| Molecular Formula | C21H20Cl2N2O2S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | N-[2-(4-chloroanilino)-2-(4-chlorophenyl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(Nc2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O2S/c1-15-2-12-20(13-3-15)28(26,27)24-14-21(16-4-6-17(22)7-5-16)25-19-10-8-18(23)9-11-19/h2-13,21,24-25H,14H2,1H3 |
| InChIKey | RTOBMEDLFCGNAS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |