C18H22ClNO3S — CID 177474536
N-[(2R)-2-[(S)-(4-chlorophenyl)-hydroxymethyl]butyl]-4-methylbenzenesulfonamide (PubChem CID 177474536) has the molecular formula C18H22ClNO3S and a molecular weight of 367.90 g/mol. Its IUPAC name is N-[(2R)-2-[(S)-(4-chlorophenyl)-hydroxymethyl]butyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-[(S)-(4-chlorophenyl)-hydroxymethyl]butyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177474536 |
| Molecular Formula | C18H22ClNO3S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[(2R)-2-[(S)-(4-chlorophenyl)-hydroxymethyl]butyl]-4-methylbenzenesulfonamide |
| SMILES | CCC(CNS(=O)(=O)c1ccc(C)cc1)[C@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClNO3S/c1-3-14(18(21)15-6-8-16(19)9-7-15)12-20-24(22,23)17-10-4-13(2)5-11-17/h4-11,14,18,20-21H,3,12H2,1-2H3/t14?,18-/m0/s1 |
| InChIKey | KIRIVZAVUCHJJG-IBYPIGCZSA-N |
| XLogP | 3.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |