C25H28ClNO2S — CID 163217185
N-[2-(4-tert-butylphenyl)-2-(4-chlorophenyl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 163217185) has the molecular formula C25H28ClNO2S and a molecular weight of 442.02 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-2-(4-chlorophenyl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-tert-butylphenyl)-2-(4-chlorophenyl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 163217185 |
| Molecular Formula | C25H28ClNO2S |
| Molecular Weight | 442.02 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-2-(4-chlorophenyl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(c2ccc(Cl)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H28ClNO2S/c1-18-5-15-23(16-6-18)30(28,29)27-17-24(20-9-13-22(26)14-10-20)19-7-11-21(12-8-19)25(2,3)4/h5-16,24,27H,17H2,1-4H3 |
| InChIKey | KMGCQITXJLZTRA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.02 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |