C25H29NO2S — CID 163217184
N-[2-(4-tert-butylphenyl)-2-phenylethyl]-4-methylbenzenesulfonamide (PubChem CID 163217184) has the molecular formula C25H29NO2S and a molecular weight of 407.58 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)-2-phenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-tert-butylphenyl)-2-phenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 163217184 |
| Molecular Formula | C25H29NO2S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)-2-phenylethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(c2ccccc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H29NO2S/c1-19-10-16-23(17-11-19)29(27,28)26-18-24(20-8-6-5-7-9-20)21-12-14-22(15-13-21)25(2,3)4/h5-17,24,26H,18H2,1-4H3 |
| InChIKey | LXDSGQXNJXBIQJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |