C22H25NO4S3 — CID 51662803
4-tert-butyl-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide (PubChem CID 51662803) has the molecular formula C22H25NO4S3 and a molecular weight of 463.65 g/mol. Its IUPAC name is 4-tert-butyl-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51662803 |
| Molecular Formula | C22H25NO4S3 |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 4-tert-butyl-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NC[C@@H](c2ccccc2)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H25NO4S3/c1-22(2,3)18-11-13-19(14-12-18)30(26,27)23-16-20(17-8-5-4-6-9-17)29(24,25)21-10-7-15-28-21/h4-15,20,23H,16H2,1-3H3/t20-/m0/s1 |
| InChIKey | FLVLAACVLJNHEN-FQEVSTJZSA-N |
| XLogP | 4.54 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |