C22H19NO5S3 — CID 41193256
N-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-4-phenylbenzenesulfonamide (PubChem CID 41193256) has the molecular formula C22H19NO5S3 and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-4-phenylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-4-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 41193256 |
| Molecular Formula | C22H19NO5S3 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | N-[(2S)-2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]-4-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(NC[C@@H](c1ccco1)S(=O)(=O)c1cccs1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO5S3/c24-30(25,22-9-5-15-29-22)21(20-8-4-14-28-20)16-23-31(26,27)19-12-10-18(11-13-19)17-6-2-1-3-7-17/h1-15,21,23H,16H2/t21-/m0/s1 |
| InChIKey | JBUOVAWIHKQLRK-NRFANRHFSA-N |
| XLogP | 4.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |