C16H14BrNO5S3 — CID 18574164
4-bromo-N-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide (PubChem CID 18574164) has the molecular formula C16H14BrNO5S3 and a molecular weight of 476.40 g/mol. Its IUPAC name is 4-bromo-N-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18574164 |
| Molecular Formula | C16H14BrNO5S3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 474.92 |
| IUPAC Name | 4-bromo-N-[2-(furan-2-yl)-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1ccco1)S(=O)(=O)c1cccs1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrNO5S3/c17-12-5-7-13(8-6-12)26(21,22)18-11-15(14-3-1-9-23-14)25(19,20)16-4-2-10-24-16/h1-10,15,18H,11H2 |
| InChIKey | SUWXVLZRBURDNV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |