C20H20FNO4S3 — CID 50753608
4-ethyl-N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide (PubChem CID 50753608) has the molecular formula C20H20FNO4S3 and a molecular weight of 453.58 g/mol. Its IUPAC name is 4-ethyl-N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 50753608 |
| Molecular Formula | C20H20FNO4S3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 4-ethyl-N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC(c2ccc(F)cc2)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H20FNO4S3/c1-2-15-5-11-18(12-6-15)29(25,26)22-14-19(16-7-9-17(21)10-8-16)28(23,24)20-4-3-13-27-20/h3-13,19,22H,2,14H2,1H3 |
| InChIKey | CFJDVIUQWDGBLM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |