C13H14FNO4S3 — CID 44649354
N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]methanesulfonamide (PubChem CID 44649354) has the molecular formula C13H14FNO4S3 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]methanesulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 44649354 |
| Molecular Formula | C13H14FNO4S3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC(c1ccc(F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H14FNO4S3/c1-21(16,17)15-9-12(10-4-6-11(14)7-5-10)22(18,19)13-3-2-8-20-13/h2-8,12,15H,9H2,1H3 |
| InChIKey | HYGXSDBCUFUJGB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |