C16H16FNO3S2 — CID 9182162
N-[(2R)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]cyclopropanecarboxamide (PubChem CID 9182162) has the molecular formula C16H16FNO3S2 and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]cyclopropanecarboxamide.
| Compound Name | N-[(2R)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 9182162 |
| Molecular Formula | C16H16FNO3S2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-[(2R)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]cyclopropanecarboxamide |
| SMILES | O=C(NC[C@@H](c1ccc(F)cc1)S(=O)(=O)c1cccs1)C1CC1 |
| InChI | InChI=1S/C16H16FNO3S2/c17-13-7-5-11(6-8-13)14(10-18-16(19)12-3-4-12)23(20,21)15-2-1-9-22-15/h1-2,5-9,12,14H,3-4,10H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | ZDMMOMZQKJLZAO-AWEZNQCLSA-N |
| XLogP | 2.93 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |