C18H20FNO3S2 — CID 110406562
N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]cyclopentanecarboxamide (PubChem CID 110406562) has the molecular formula C18H20FNO3S2 and a molecular weight of 381.49 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 110406562 |
| Molecular Formula | C18H20FNO3S2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]cyclopentanecarboxamide |
| SMILES | O=C(NCC(c1ccc(F)cc1)S(=O)(=O)c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C18H20FNO3S2/c19-15-9-7-13(8-10-15)16(25(22,23)17-6-3-11-24-17)12-20-18(21)14-4-1-2-5-14/h3,6-11,14,16H,1-2,4-5,12H2,(H,20,21) |
| InChIKey | GQMADJVJDDHBAM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |