C17H14FNO4S2 — CID 9182290
N-[(2S)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]furan-2-carboxamide (PubChem CID 9182290) has the molecular formula C17H14FNO4S2 and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[(2S)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]furan-2-carboxamide.
| Compound Name | N-[(2S)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9182290 |
| Molecular Formula | C17H14FNO4S2 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[(2S)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]furan-2-carboxamide |
| SMILES | O=C(NC[C@H](c1ccc(F)cc1)S(=O)(=O)c1cccs1)c1ccco1 |
| InChI | InChI=1S/C17H14FNO4S2/c18-13-7-5-12(6-8-13)15(25(21,22)16-4-2-10-24-16)11-19-17(20)14-3-1-9-23-14/h1-10,15H,11H2,(H,19,20)/t15-/m1/s1 |
| InChIKey | FXJKCSZBIDTYOO-OAHLLOKOSA-N |
| XLogP | 3.43 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |