C19H16FNO4S — CID 110315060
N-[2-(4-fluorophenyl)sulfonyl-2-phenylethyl]furan-2-carboxamide (PubChem CID 110315060) has the molecular formula C19H16FNO4S and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)sulfonyl-2-phenylethyl]furan-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)sulfonyl-2-phenylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110315060 |
| Molecular Formula | C19H16FNO4S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-[2-(4-fluorophenyl)sulfonyl-2-phenylethyl]furan-2-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)S(=O)(=O)c1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C19H16FNO4S/c20-15-8-10-16(11-9-15)26(23,24)18(14-5-2-1-3-6-14)13-21-19(22)17-7-4-12-25-17/h1-12,18H,13H2,(H,21,22) |
| InChIKey | HMAQOKBGVRAZFG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |