C17H17FN2O4S2 — CID 9182698
N'-[(2S)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]-N-prop-2-enyloxamide (PubChem CID 9182698) has the molecular formula C17H17FN2O4S2 and a molecular weight of 396.47 g/mol. Its IUPAC name is N'-[(2S)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]-N-prop-2-enyloxamide.
| Compound Name | N'-[(2S)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 9182698 |
| Molecular Formula | C17H17FN2O4S2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N'-[(2S)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NC[C@H](c1ccc(F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H17FN2O4S2/c1-2-9-19-16(21)17(22)20-11-14(12-5-7-13(18)8-6-12)26(23,24)15-4-3-10-25-15/h2-8,10,14H,1,9,11H2,(H,19,21)(H,20,22)/t14-/m1/s1 |
| InChIKey | HWEKTNGHIDDVDB-CQSZACIVSA-N |
| XLogP | 1.82 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|