C20H18FNO3S2 — CID 9182326
N-[(2R)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]-2-methylbenzamide (PubChem CID 9182326) has the molecular formula C20H18FNO3S2 and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]-2-methylbenzamide.
| Compound Name | N-[(2R)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 9182326 |
| Molecular Formula | C20H18FNO3S2 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-[(2R)-2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC[C@@H](c1ccc(F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H18FNO3S2/c1-14-5-2-3-6-17(14)20(23)22-13-18(15-8-10-16(21)11-9-15)27(24,25)19-7-4-12-26-19/h2-12,18H,13H2,1H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | BUHLWQOMNGCTAW-SFHVURJKSA-N |
| XLogP | 4.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |