C15H18FNO4S3 — CID 44649356
N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]propane-1-sulfonamide (PubChem CID 44649356) has the molecular formula C15H18FNO4S3 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]propane-1-sulfonamide.
| Compound Name | N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 44649356 |
| Molecular Formula | C15H18FNO4S3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-thiophen-2-ylsulfonylethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCC(c1ccc(F)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H18FNO4S3/c1-2-10-23(18,19)17-11-14(12-5-7-13(16)8-6-12)24(20,21)15-4-3-9-22-15/h3-9,14,17H,2,10-11H2,1H3 |
| InChIKey | UFRFZKRFSNIEPS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |