C14H18N2O4S3 — CID 110605719
N-(ethylsulfamoyl)-2-phenyl-2-thiophen-2-ylsulfonylethanamine (PubChem CID 110605719) has the molecular formula C14H18N2O4S3 and a molecular weight of 374.51 g/mol. Its IUPAC name is N-(ethylsulfamoyl)-2-phenyl-2-thiophen-2-ylsulfonylethanamine.
| Compound Name | N-(ethylsulfamoyl)-2-phenyl-2-thiophen-2-ylsulfonylethanamine |
|---|---|
| PubChem CID | 110605719 |
| Molecular Formula | C14H18N2O4S3 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-(ethylsulfamoyl)-2-phenyl-2-thiophen-2-ylsulfonylethanamine |
| SMILES | CCNS(=O)(=O)NCC(c1ccccc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H18N2O4S3/c1-2-15-23(19,20)16-11-13(12-7-4-3-5-8-12)22(17,18)14-9-6-10-21-14/h3-10,13,15-16H,2,11H2,1H3 |
| InChIKey | DKCYTAQJWSTOHY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |