C17H23NO4S3 — CID 9181104
N-[(2S)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]butane-1-sulfonamide (PubChem CID 9181104) has the molecular formula C17H23NO4S3 and a molecular weight of 401.58 g/mol. Its IUPAC name is N-[(2S)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]butane-1-sulfonamide.
| Compound Name | N-[(2S)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 9181104 |
| Molecular Formula | C17H23NO4S3 |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-[(2S)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC[C@H](c1ccc(C)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H23NO4S3/c1-3-4-12-24(19,20)18-13-16(15-9-7-14(2)8-10-15)25(21,22)17-6-5-11-23-17/h5-11,16,18H,3-4,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | XTIOWWNMJSDXIS-MRXNPFEDSA-N |
| XLogP | 3.29 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |