C18H18N2O4S3 — CID 40903607
4-methyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide (PubChem CID 40903607) has the molecular formula C18H18N2O4S3 and a molecular weight of 422.55 g/mol. Its IUPAC name is 4-methyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40903607 |
| Molecular Formula | C18H18N2O4S3 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 4-methyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@@H](c2cccnc2)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H18N2O4S3/c1-14-6-8-16(9-7-14)27(23,24)20-13-17(15-4-2-10-19-12-15)26(21,22)18-5-3-11-25-18/h2-12,17,20H,13H2,1H3/t17-/m0/s1 |
| InChIKey | YWERZIDEXWZSPZ-KRWDZBQOSA-N |
| XLogP | 2.95 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |