C20H22N2O5S3 — CID 21007549
4-propan-2-yloxy-N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide (PubChem CID 21007549) has the molecular formula C20H22N2O5S3 and a molecular weight of 466.61 g/mol. Its IUPAC name is 4-propan-2-yloxy-N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide.
| Compound Name | 4-propan-2-yloxy-N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 21007549 |
| Molecular Formula | C20H22N2O5S3 |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 4-propan-2-yloxy-N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)NCC(c2cccnc2)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H22N2O5S3/c1-15(2)27-17-7-9-18(10-8-17)30(25,26)22-14-19(16-5-3-11-21-13-16)29(23,24)20-6-4-12-28-20/h3-13,15,19,22H,14H2,1-2H3 |
| InChIKey | RKQVYQLGURKOPH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |