C23H25NO5S3 — CID 51662791
4-cyclopentyloxy-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide (PubChem CID 51662791) has the molecular formula C23H25NO5S3 and a molecular weight of 491.66 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide.
| Compound Name | 4-cyclopentyloxy-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51662791 |
| Molecular Formula | C23H25NO5S3 |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 4-cyclopentyloxy-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@@H](c1ccccc1)S(=O)(=O)c1cccs1)c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C23H25NO5S3/c25-31(26,23-11-6-16-30-23)22(18-7-2-1-3-8-18)17-24-32(27,28)21-14-12-20(13-15-21)29-19-9-4-5-10-19/h1-3,6-8,11-16,19,22,24H,4-5,9-10,17H2/t22-/m0/s1 |
| InChIKey | VZFHIQRXPQXKGT-QFIPXVFZSA-N |
| XLogP | 4.56 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |