C21H21FN2O5S2 — CID 20996522
N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-methoxybenzenesulfonamide (PubChem CID 20996522) has the molecular formula C21H21FN2O5S2 and a molecular weight of 464.54 g/mol. Its IUPAC name is N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 20996522 |
| Molecular Formula | C21H21FN2O5S2 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(c2cccnc2)S(=O)(=O)c2ccc(F)c(C)c2)cc1 |
| InChI | InChI=1S/C21H21FN2O5S2/c1-15-12-19(9-10-20(15)22)30(25,26)21(16-4-3-11-23-13-16)14-24-31(27,28)18-7-5-17(29-2)6-8-18/h3-13,21,24H,14H2,1-2H3 |
| InChIKey | IROHOJJDCMGNSF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |