C22H23FN2O5S2 — CID 21007728
N-[2-(4-ethoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 21007728) has the molecular formula C22H23FN2O5S2 and a molecular weight of 478.57 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-ethoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 21007728 |
| Molecular Formula | C22H23FN2O5S2 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[2-(4-ethoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)C(CNS(=O)(=O)c2ccc(F)cc2C)c2cccnc2)cc1 |
| InChI | InChI=1S/C22H23FN2O5S2/c1-3-30-19-7-9-20(10-8-19)31(26,27)22(17-5-4-12-24-14-17)15-25-32(28,29)21-11-6-18(23)13-16(21)2/h4-14,22,25H,3,15H2,1-2H3 |
| InChIKey | QXDILNRACPSZGP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |