C22H29N3O4S — CID 21007706
1-cyclohexyl-3-[2-(4-ethoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]urea (PubChem CID 21007706) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(4-ethoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(4-ethoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 21007706 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 1-cyclohexyl-3-[2-(4-ethoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]urea |
| SMILES | CCOc1ccc(S(=O)(=O)C(CNC(=O)NC2CCCCC2)c2cccnc2)cc1 |
| InChI | InChI=1S/C22H29N3O4S/c1-2-29-19-10-12-20(13-11-19)30(27,28)21(17-7-6-14-23-15-17)16-24-22(26)25-18-8-4-3-5-9-18/h6-7,10-15,18,21H,2-5,8-9,16H2,1H3,(H2,24,25,26) |
| InChIKey | JNEXUSKQKBQYHW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |