C20H18F2N2O4S2 — CID 20996520
4-fluoro-N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]benzenesulfonamide (PubChem CID 20996520) has the molecular formula C20H18F2N2O4S2 and a molecular weight of 452.50 g/mol. Its IUPAC name is 4-fluoro-N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20996520 |
| Molecular Formula | C20H18F2N2O4S2 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 4-fluoro-N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)C(CNS(=O)(=O)c2ccc(F)cc2)c2cccnc2)ccc1F |
| InChI | InChI=1S/C20H18F2N2O4S2/c1-14-11-18(8-9-19(14)22)29(25,26)20(15-3-2-10-23-12-15)13-24-30(27,28)17-6-4-16(21)5-7-17/h2-12,20,24H,13H2,1H3 |
| InChIKey | GRXPEVYHJFWGBT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |