C19H20N2O5S3 — CID 20995702
4-methoxy-3-methyl-N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide (PubChem CID 20995702) has the molecular formula C19H20N2O5S3 and a molecular weight of 452.58 g/mol. Its IUPAC name is 4-methoxy-3-methyl-N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide.
| Compound Name | 4-methoxy-3-methyl-N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20995702 |
| Molecular Formula | C19H20N2O5S3 |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 4-methoxy-3-methyl-N-(2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(c2cccnc2)S(=O)(=O)c2cccs2)cc1C |
| InChI | InChI=1S/C19H20N2O5S3/c1-14-11-16(7-8-17(14)26-2)29(24,25)21-13-18(15-5-3-9-20-12-15)28(22,23)19-6-4-10-27-19/h3-12,18,21H,13H2,1-2H3 |
| InChIKey | FTELCRLNVIOYMP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |