C21H20ClNO2S2 — CID 4544366
4-chloro-N-[2-(4-methylphenyl)sulfanyl-2-phenylethyl]benzenesulfonamide (PubChem CID 4544366) has the molecular formula C21H20ClNO2S2 and a molecular weight of 417.98 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-methylphenyl)sulfanyl-2-phenylethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(4-methylphenyl)sulfanyl-2-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4544366 |
| Molecular Formula | C21H20ClNO2S2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 4-chloro-N-[2-(4-methylphenyl)sulfanyl-2-phenylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(SC(CNS(=O)(=O)c2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20ClNO2S2/c1-16-7-11-19(12-8-16)26-21(17-5-3-2-4-6-17)15-23-27(24,25)20-13-9-18(22)10-14-20/h2-14,21,23H,15H2,1H3 |
| InChIKey | POLHAIBCMQABTA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |