C22H20ClNO3S2 — CID 16731789
S-(4-chlorophenyl) (3S)-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanethioate (PubChem CID 16731789) has the molecular formula C22H20ClNO3S2 and a molecular weight of 445.99 g/mol. Its IUPAC name is S-(4-chlorophenyl) (3S)-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanethioate.
| Compound Name | S-(4-chlorophenyl) (3S)-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanethioate |
|---|---|
| PubChem CID | 16731789 |
| Molecular Formula | C22H20ClNO3S2 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | S-(4-chlorophenyl) (3S)-3-[(4-methylphenyl)sulfonylamino]-3-phenylpropanethioate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](CC(=O)Sc2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20ClNO3S2/c1-16-7-13-20(14-8-16)29(26,27)24-21(17-5-3-2-4-6-17)15-22(25)28-19-11-9-18(23)10-12-19/h2-14,21,24H,15H2,1H3/t21-/m0/s1 |
| InChIKey | MZRPVLIBIOZPDR-NRFANRHFSA-N |
| XLogP | 5.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|