C20H23NO5S — CID 102079264
ethyl 5-[(4-methylphenyl)sulfonylamino]-3-oxo-5-phenylpentanoate (PubChem CID 102079264) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is ethyl 5-[(4-methylphenyl)sulfonylamino]-3-oxo-5-phenylpentanoate.
| Compound Name | ethyl 5-[(4-methylphenyl)sulfonylamino]-3-oxo-5-phenylpentanoate |
|---|---|
| PubChem CID | 102079264 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | ethyl 5-[(4-methylphenyl)sulfonylamino]-3-oxo-5-phenylpentanoate |
| SMILES | CCOC(=O)CC(=O)CC(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO5S/c1-3-26-20(23)14-17(22)13-19(16-7-5-4-6-8-16)21-27(24,25)18-11-9-15(2)10-12-18/h4-12,19,21H,3,13-14H2,1-2H3 |
| InChIKey | DVYFMZJHADANRV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|