C16H18ClNO2S — CID 4961653
N-(3-chloro-1-phenylpropyl)-4-methylbenzenesulfonamide (PubChem CID 4961653) has the molecular formula C16H18ClNO2S and a molecular weight of 323.85 g/mol. Its IUPAC name is N-(3-chloro-1-phenylpropyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3-chloro-1-phenylpropyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4961653 |
| Molecular Formula | C16H18ClNO2S |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-(3-chloro-1-phenylpropyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCCl)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18ClNO2S/c1-13-7-9-15(10-8-13)21(19,20)18-16(11-12-17)14-5-3-2-4-6-14/h2-10,16,18H,11-12H2,1H3 |
| InChIKey | BFLCGGJYJGGLGQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|